About 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid
2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid (PubChem CID 69374994) has the molecular formula C26H34N4O2
and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid |
| PubChem CID | 69374994 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid |
| SMILES | CCc1ccc(CC(N)(C(=O)O)c2nc3ccccc3n2C2CCN(C)CC2)cc1CC |
| InChI | InChI=1S/C26H34N4O2/c1-4-19-11-10-18(16-20(19)5-2)17-26(27,25(31)32)24-28-22-8-6-7-9-23(22)30(24)21-12-14-29(3)15-13-21/h6-11,16,21H,4-5,12-15,17,27H2,1-3H3,(H,31,32) |
| InChIKey | SARIXXHZCMPDFU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid?
The IUPAC name of 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid (CID 69374994) is 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid?
The canonical SMILES for 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid is CCc1ccc(CC(N)(C(=O)O)c2nc3ccccc3n2C2CCN(C)CC2)cc1CC.
What is the InChIKey of 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid?
The InChIKey is SARIXXHZCMPDFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N4O2/c1-4-19-11-10-18(16-20(19)5-2)17-26(27,25(31)32)24-28-22-8-6-7-9-23(22)30(24)21-12-14-29(3)15-13-21/h6-11,16,21H,4-5,12-15,17,27H2,1-3H3,(H,31,32).
What are the key properties of 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid?
2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid has a molecular weight of 434.58 g/mol, XLogP of 3.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3,4-diethylphenyl)-2-[1-(1-methylpiperidin-4-yl)benzimidazol-2-yl]propanoic acid is sourced from PubChem (CID 69374994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).