About 5-fluoro-2H-triazolo[4,5-d]pyrimidine
5-fluoro-2H-triazolo[4,5-d]pyrimidine (PubChem CID 69375370) has the molecular formula C4H2FN5
and a molecular weight of 139.09 g/mol. Its IUPAC name is 5-fluoro-2H-triazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2H-triazolo[4,5-d]pyrimidine |
| PubChem CID | 69375370 |
| Molecular Formula | C4H2FN5 |
| Molecular Weight | 139.09 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | 5-fluoro-2H-triazolo[4,5-d]pyrimidine |
| SMILES | Fc1ncc2n[nH]nc2n1 |
| InChI | InChI=1S/C4H2FN5/c5-4-6-1-2-3(7-4)9-10-8-2/h1H,(H,6,7,8,9,10) |
| InChIKey | KYQPUBIBQFGDJT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.09 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2H-triazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2H-triazolo[4,5-d]pyrimidine?
The IUPAC name of 5-fluoro-2H-triazolo[4,5-d]pyrimidine (CID 69375370) is 5-fluoro-2H-triazolo[4,5-d]pyrimidine.
What is the SMILES notation for 5-fluoro-2H-triazolo[4,5-d]pyrimidine?
The canonical SMILES for 5-fluoro-2H-triazolo[4,5-d]pyrimidine is Fc1ncc2n[nH]nc2n1.
What is the InChIKey of 5-fluoro-2H-triazolo[4,5-d]pyrimidine?
The InChIKey is KYQPUBIBQFGDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2FN5/c5-4-6-1-2-3(7-4)9-10-8-2/h1H,(H,6,7,8,9,10).
What are the key properties of 5-fluoro-2H-triazolo[4,5-d]pyrimidine?
5-fluoro-2H-triazolo[4,5-d]pyrimidine has a molecular weight of 139.09 g/mol, XLogP of -0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2H-triazolo[4,5-d]pyrimidine is sourced from PubChem (CID 69375370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).