C14H18Cl2N2O — CID 69376073
2-amino-3,5-dichloro-N-cyclohexyl-N-methylbenzamide (PubChem CID 69376073) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-amino-3,5-dichloro-N-cyclohexyl-N-methylbenzamide.
| Compound Name | 2-amino-3,5-dichloro-N-cyclohexyl-N-methylbenzamide |
|---|---|
| PubChem CID | 69376073 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-amino-3,5-dichloro-N-cyclohexyl-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(Cl)cc(Cl)c1N)C1CCCCC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-18(10-5-3-2-4-6-10)14(19)11-7-9(15)8-12(16)13(11)17/h7-8,10H,2-6,17H2,1H3 |
| InChIKey | RCTHPLFEUBFBAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|