About [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium
[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium (PubChem CID 6937612) has the molecular formula C16H26NO+
and a molecular weight of 248.39 g/mol. Its IUPAC name is [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium.
Molecular Properties
| Compound Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium |
| PubChem CID | 6937612 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium |
| SMILES | CC1(C)C[C@H]([C@@H](CC[NH3+])c2ccccc2)CCO1 |
| InChI | InChI=1S/C16H25NO/c1-16(2)12-14(9-11-18-16)15(8-10-17)13-6-4-3-5-7-13/h3-7,14-15H,8-12,17H2,1-2H3/p+1/t14-,15+/m1/s1 |
| InChIKey | PKJTUAABUQKSKU-CABCVRRESA-O |
| XLogP | 2.61 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium?
The IUPAC name of [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium (CID 6937612) is [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium.
What is the SMILES notation for [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium?
The canonical SMILES for [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium is CC1(C)C[C@H]([C@@H](CC[NH3+])c2ccccc2)CCO1.
What is the InChIKey of [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium?
The InChIKey is PKJTUAABUQKSKU-CABCVRRESA-O. The full InChI is InChI=1S/C16H25NO/c1-16(2)12-14(9-11-18-16)15(8-10-17)13-6-4-3-5-7-13/h3-7,14-15H,8-12,17H2,1-2H3/p+1/t14-,15+/m1/s1.
What are the key properties of [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium?
[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium has a molecular weight of 248.39 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azanium is sourced from PubChem (CID 6937612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).