C11H10N2O2 — CID 69376851
2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-amine (PubChem CID 69376851) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-amine.
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-amine |
|---|---|
| PubChem CID | 69376851 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-amine |
| SMILES | Nc1ccnc2ccc3c(c12)OCCO3 |
| InChI | InChI=1S/C11H10N2O2/c12-7-3-4-13-8-1-2-9-11(10(7)8)15-6-5-14-9/h1-4H,5-6H2,(H2,12,13) |
| InChIKey | SLXZIXVHWDLGEI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |