About 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole
3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole (PubChem CID 69377551) has the molecular formula C21H19N3
and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole.
Molecular Properties
| Compound Name | 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole |
| PubChem CID | 69377551 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole |
| SMILES | Cc1ccc(C)n1-c1ccccc1/C=C/c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C21H19N3/c1-15-11-12-16(2)24(15)21-10-6-3-7-17(21)13-14-20-18-8-4-5-9-19(18)22-23-20/h3-14H,1-2H3,(H,22,23)/b14-13+ |
| InChIKey | FBUMTTNSLULQBP-BUHFOSPRSA-N |
| XLogP | 5.14 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole?
The IUPAC name of 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole (CID 69377551) is 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole.
What is the SMILES notation for 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole?
The canonical SMILES for 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole is Cc1ccc(C)n1-c1ccccc1/C=C/c1n[nH]c2ccccc12.
What is the InChIKey of 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole?
The InChIKey is FBUMTTNSLULQBP-BUHFOSPRSA-N. The full InChI is InChI=1S/C21H19N3/c1-15-11-12-16(2)24(15)21-10-6-3-7-17(21)13-14-20-18-8-4-5-9-19(18)22-23-20/h3-14H,1-2H3,(H,22,23)/b14-13+.
What are the key properties of 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole?
3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole has a molecular weight of 313.40 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-[2-(2,5-dimethylpyrrol-1-yl)phenyl]ethenyl]-1H-indazole is sourced from PubChem (CID 69377551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).