About 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine
3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine (PubChem CID 69377762) has the molecular formula C23H22ClN3O2S
and a molecular weight of 439.97 g/mol. Its IUPAC name is 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine |
| PubChem CID | 69377762 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine |
| SMILES | CCCS(=O)c1ccc(-c2c(-c3ccc(OC)cc3)nc3nc(C)ccn23)cc1Cl |
| InChI | InChI=1S/C23H22ClN3O2S/c1-4-13-30(28)20-10-7-17(14-19(20)24)22-21(16-5-8-18(29-3)9-6-16)26-23-25-15(2)11-12-27(22)23/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | NUGZGFQDQJNXDX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine?
The IUPAC name of 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine (CID 69377762) is 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine is CCCS(=O)c1ccc(-c2c(-c3ccc(OC)cc3)nc3nc(C)ccn23)cc1Cl.
What is the InChIKey of 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine?
The InChIKey is NUGZGFQDQJNXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClN3O2S/c1-4-13-30(28)20-10-7-17(14-19(20)24)22-21(16-5-8-18(29-3)9-6-16)26-23-25-15(2)11-12-27(22)23/h5-12,14H,4,13H2,1-3H3.
What are the key properties of 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine?
3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine has a molecular weight of 439.97 g/mol, XLogP of 5.55, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-4-propylsulfinylphenyl)-2-(4-methoxyphenyl)-7-methylimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 69377762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).