C23H26FNO5 — CID 69378345
(2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-1H-indol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 69378345) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-1H-indol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-1H-indol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 69378345 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-ethylphenyl)methyl]-4-fluoro-1H-indol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[nH]c3cccc(F)c23)cc1 |
| InChI | InChI=1S/C23H26FNO5/c1-2-12-6-8-13(9-7-12)10-14-18-15(24)4-3-5-16(18)25-19(14)23-22(29)21(28)20(27)17(11-26)30-23/h3-9,17,20-23,25-29H,2,10-11H2,1H3/t17-,20-,21+,22-,23+/m1/s1 |
| InChIKey | GQTBXGHOSRFLTA-PHNZBSFLSA-N |
| XLogP | 1.98 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |