About 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid
2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid (PubChem CID 69378595) has the molecular formula C16H15ClN4O3
and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid |
| PubChem CID | 69378595 |
| Molecular Formula | C16H15ClN4O3 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid |
| SMILES | NC(=O)c1cc(Cl)ccc1N.O=C(O)C1=NCNc2ccccc21 |
| InChI | InChI=1S/C9H8N2O2.C7H7ClN2O/c12-9(13)8-6-3-1-2-4-7(6)10-5-11-8;8-4-1-2-6(9)5(3-4)7(10)11/h1-4,10H,5H2,(H,12,13);1-3H,9H2,(H2,10,11) |
| InChIKey | PHHFHTPCUGBVJS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid?
The IUPAC name of 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid (CID 69378595) is 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid?
The canonical SMILES for 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid is NC(=O)c1cc(Cl)ccc1N.O=C(O)C1=NCNc2ccccc21.
What is the InChIKey of 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid?
The InChIKey is PHHFHTPCUGBVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2.C7H7ClN2O/c12-9(13)8-6-3-1-2-4-7(6)10-5-11-8;8-4-1-2-6(9)5(3-4)7(10)11/h1-4,10H,5H2,(H,12,13);1-3H,9H2,(H2,10,11).
What are the key properties of 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid?
2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid has a molecular weight of 346.77 g/mol, XLogP of 1.96, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-chlorobenzamide;1,2-dihydroquinazoline-4-carboxylic acid is sourced from PubChem (CID 69378595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).