About 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid
2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid (PubChem CID 69378857) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| PubChem CID | 69378857 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid |
| SMILES | CCCC1(OCC(=O)O)C=CC(C(C)C)=CC1O |
| InChI | InChI=1S/C14H22O4/c1-4-6-14(18-9-13(16)17)7-5-11(10(2)3)8-12(14)15/h5,7-8,10,12,15H,4,6,9H2,1-3H3,(H,16,17) |
| InChIKey | RJXOVFORYZYVNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The IUPAC name of 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid (CID 69378857) is 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid.
What is the SMILES notation for 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The canonical SMILES for 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid is CCCC1(OCC(=O)O)C=CC(C(C)C)=CC1O.
What is the InChIKey of 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
The InChIKey is RJXOVFORYZYVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-4-6-14(18-9-13(16)17)7-5-11(10(2)3)8-12(14)15/h5,7-8,10,12,15H,4,6,9H2,1-3H3,(H,16,17).
What are the key properties of 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid?
2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid has a molecular weight of 254.33 g/mol, XLogP of 2.14, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxy-4-propan-2-yl-1-propylcyclohexa-2,4-dien-1-yl)oxyacetic acid is sourced from PubChem (CID 69378857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).