C10H16N4O3S — CID 69378913
3,3-dioxo-3λ6-thia-1,2,8,13-tetrazatricyclo[8.2.1.14,7]tetradeca-10(13),11-dien-9-one;methane (PubChem CID 69378913) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 3,3-dioxo-3λ6-thia-1,2,8,13-tetrazatricyclo[8.2.1.14,7]tetradeca-10(13),11-dien-9-one;methane.
| Compound Name | 3,3-dioxo-3λ6-thia-1,2,8,13-tetrazatricyclo[8.2.1.14,7]tetradeca-10(13),11-dien-9-one;methane |
|---|---|
| PubChem CID | 69378913 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3,3-dioxo-3λ6-thia-1,2,8,13-tetrazatricyclo[8.2.1.14,7]tetradeca-10(13),11-dien-9-one;methane |
| SMILES | C.O=C1NC2CCC(C2)S(=O)(=O)Nn2ccc1n2 |
| InChI | InChI=1S/C9H12N4O3S.CH4/c14-9-8-3-4-13(11-8)12-17(15,16)7-2-1-6(5-7)10-9;/h3-4,6-7,12H,1-2,5H2,(H,10,14);1H4 |
| InChIKey | AAUIEWRJMVGNSV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |