C15H12F3N5O3 — CID 69379256
5-[(4-methoxyphenyl)methyl]-4-nitro-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-1H-pyrazole (PubChem CID 69379256) has the molecular formula C15H12F3N5O3 and a molecular weight of 367.29 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methyl]-4-nitro-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-1H-pyrazole.
| Compound Name | 5-[(4-methoxyphenyl)methyl]-4-nitro-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 69379256 |
| Molecular Formula | C15H12F3N5O3 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 5-[(4-methoxyphenyl)methyl]-4-nitro-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-1H-pyrazole |
| SMILES | COc1ccc(Cc2[nH]nc(-c3cn[nH]c3C(F)(F)F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12F3N5O3/c1-26-9-4-2-8(3-5-9)6-11-13(23(24)25)12(21-20-11)10-7-19-22-14(10)15(16,17)18/h2-5,7H,6H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | HEJOECWUXSNYQA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|