About N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide
N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 69379379) has the molecular formula C6H6F3N3O
and a molecular weight of 193.13 g/mol. Its IUPAC name is N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide |
| PubChem CID | 69379379 |
| Molecular Formula | C6H6F3N3O |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | O=C(NC(F)(F)F)C1=CNC=NC1 |
| InChI | InChI=1S/C6H6F3N3O/c7-6(8,9)12-5(13)4-1-10-3-11-2-4/h1,3H,2H2,(H,10,11)(H,12,13) |
| InChIKey | GSAWJTXJMGFSLI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide?
The IUPAC name of N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide (CID 69379379) is N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide.
What is the SMILES notation for N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide?
The canonical SMILES for N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide is O=C(NC(F)(F)F)C1=CNC=NC1.
What is the InChIKey of N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide?
The InChIKey is GSAWJTXJMGFSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F3N3O/c7-6(8,9)12-5(13)4-1-10-3-11-2-4/h1,3H,2H2,(H,10,11)(H,12,13).
What are the key properties of N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide?
N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide has a molecular weight of 193.13 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(trifluoromethyl)-1,4-dihydropyrimidine-5-carboxamide is sourced from PubChem (CID 69379379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).