C22H22F3NO5 — CID 69379476
(2R,3S,4R,5S,6S)-4-[[4-(difluoromethyl)phenyl]methyl]-3-fluoro-2-(hydroxymethyl)-6-(1H-indol-2-yl)oxane-3,4,5-triol (PubChem CID 69379476) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is (2R,3S,4R,5S,6S)-4-[[4-(difluoromethyl)phenyl]methyl]-3-fluoro-2-(hydroxymethyl)-6-(1H-indol-2-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6S)-4-[[4-(difluoromethyl)phenyl]methyl]-3-fluoro-2-(hydroxymethyl)-6-(1H-indol-2-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 69379476 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2R,3S,4R,5S,6S)-4-[[4-(difluoromethyl)phenyl]methyl]-3-fluoro-2-(hydroxymethyl)-6-(1H-indol-2-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc3ccccc3[nH]2)[C@H](O)[C@](O)(Cc2ccc(C(F)F)cc2)[C@@]1(O)F |
| InChI | InChI=1S/C22H22F3NO5/c23-20(24)13-7-5-12(6-8-13)10-21(29)19(28)18(31-17(11-27)22(21,25)30)16-9-14-3-1-2-4-15(14)26-16/h1-9,17-20,26-30H,10-11H2/t17-,18+,19+,21-,22-/m1/s1 |
| InChIKey | WOEWZRZNAGLPKG-YUQCVWRMSA-N |
| XLogP | 2.53 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |