C6H11N5O — CID 693795
6-ethoxy-2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 693795) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 6-ethoxy-2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 693795 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 6-ethoxy-2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(NC)n1 |
| InChI | InChI=1S/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11) |
| InChIKey | HEMSJLNVJJUYEU-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |