C23H23Cl2FN4O — CID 69379783
(3S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 69379783) has the molecular formula C23H23Cl2FN4O and a molecular weight of 461.37 g/mol. Its IUPAC name is (3S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69379783 |
| Molecular Formula | C23H23Cl2FN4O |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3S)-N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-(2,4-dichlorophenyl)-3-(4-fluorophenyl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | O=C(NN1CC2CCCC2C1)C1=NN(c2ccc(Cl)cc2Cl)[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H23Cl2FN4O/c24-17-6-9-21(19(25)10-17)30-22(14-4-7-18(26)8-5-14)11-20(27-30)23(31)28-29-12-15-2-1-3-16(15)13-29/h4-10,15-16,22H,1-3,11-13H2,(H,28,31)/t15?,16?,22-/m0/s1 |
| InChIKey | SDZTYYCZGZXUBV-LGHDPPOTSA-N |
| XLogP | 5.20 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |