tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate

C13H11F3N2O3 — CID 69379897

IUPACtert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate
SMILESCC(C)(C)OC(=O)c1c(C(F)(F)F)ccc2c1=NC(=O)N=2
InChIInChI=1S/C13H11F3N2O3/c1-12(2,3)21-10(19)8-6(13(14,15)16)4-5-7-9(8)18-11(20)17-7/h4-5H,1-3H3
InChIKeyXOFOPWCVYNEJML-UHFFFAOYSA-N
MW300.24 g/mol
LogP2.03
Rot. Bonds1

About tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate

tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate (PubChem CID 69379897) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate.

Molecular Properties

Compound Nametert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate
PubChem CID69379897
Molecular FormulaC13H11F3N2O3
Molecular Weight300.24 g/mol
Exact Mass300.07
IUPAC Nametert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate
SMILESCC(C)(C)OC(=O)c1c(C(F)(F)F)ccc2c1=NC(=O)N=2
InChIInChI=1S/C13H11F3N2O3/c1-12(2,3)21-10(19)8-6(13(14,15)16)4-5-7-9(8)18-11(20)17-7/h4-5H,1-3H3
InChIKeyXOFOPWCVYNEJML-UHFFFAOYSA-N
XLogP2.03
TPSA68.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.24
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate?
The IUPAC name of tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate (CID 69379897) is tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate.
What is the SMILES notation for tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate?
The canonical SMILES for tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate is CC(C)(C)OC(=O)c1c(C(F)(F)F)ccc2c1=NC(=O)N=2.
What is the InChIKey of tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate?
The InChIKey is XOFOPWCVYNEJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O3/c1-12(2,3)21-10(19)8-6(13(14,15)16)4-5-7-9(8)18-11(20)17-7/h4-5H,1-3H3.
What are the key properties of tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate?
tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate has a molecular weight of 300.24 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-oxo-5-(trifluoromethyl)benzimidazole-4-carboxylate is sourced from PubChem (CID 69379897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).