C17H19N3O — CID 69380368
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]quinoline-8-carboxamide (PubChem CID 69380368) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]quinoline-8-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 69380368 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]quinoline-8-carboxamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1cccc2cccnc12 |
| InChI | InChI=1S/C17H19N3O/c21-17(19-15-11-20-9-6-12(15)7-10-20)14-5-1-3-13-4-2-8-18-16(13)14/h1-5,8,12,15H,6-7,9-11H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | MCDTVZXOPLFCOT-HNNXBMFYSA-N |
| XLogP | 2.06 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |