C14H24ClFN2+2 — CID 6938049
(2-chloro-6-fluorophenyl)methyl-[2-(diethylazaniumyl)ethyl]-methylazanium (PubChem CID 6938049) has the molecular formula C14H24ClFN2+2 and a molecular weight of 274.81 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl-[2-(diethylazaniumyl)ethyl]-methylazanium.
| Compound Name | (2-chloro-6-fluorophenyl)methyl-[2-(diethylazaniumyl)ethyl]-methylazanium |
|---|---|
| PubChem CID | 6938049 |
| Molecular Formula | C14H24ClFN2+2 |
| Molecular Weight | 274.81 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl-[2-(diethylazaniumyl)ethyl]-methylazanium |
| SMILES | CC[NH+](CC)CC[NH+](C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H22ClFN2/c1-4-18(5-2)10-9-17(3)11-12-13(15)7-6-8-14(12)16/h6-8H,4-5,9-11H2,1-3H3/p+2 |
| InChIKey | SMVYVDHAFRIEQF-UHFFFAOYSA-P |
| XLogP | 0.42 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.81 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |