C32H37N5O9 — CID 69380753
2-(3-carbamimidoylanilino)-N-[4-(morpholine-4-carbonyl)phenyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide (PubChem CID 69380753) has the molecular formula C32H37N5O9 and a molecular weight of 635.67 g/mol. Its IUPAC name is 2-(3-carbamimidoylanilino)-N-[4-(morpholine-4-carbonyl)phenyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide.
| Compound Name | 2-(3-carbamimidoylanilino)-N-[4-(morpholine-4-carbonyl)phenyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 69380753 |
| Molecular Formula | C32H37N5O9 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | 2-(3-carbamimidoylanilino)-N-[4-(morpholine-4-carbonyl)phenyl]-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(NC(C(=O)Nc2ccc(C(=O)N3CCOCC3)cc2)c2ccccc2OC2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C32H37N5O9/c33-29(34)19-4-3-5-21(16-19)35-25(30(42)36-20-10-8-18(9-11-20)31(43)37-12-14-44-15-13-37)22-6-1-2-7-23(22)45-32-28(41)27(40)26(39)24(17-38)46-32/h1-11,16,24-28,32,35,38-41H,12-15,17H2,(H3,33,34)(H,36,42) |
| InChIKey | HWZCNHYSRKFWKM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 219.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|