About 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine
2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine (PubChem CID 69381236) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine.
Molecular Properties
| Compound Name | 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine |
| PubChem CID | 69381236 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine |
| SMILES | C=CCCC(C)(NCC=C)N1C=NCC1 |
| InChI | InChI=1S/C12H21N3/c1-4-6-7-12(3,14-8-5-2)15-10-9-13-11-15/h4-5,11,14H,1-2,6-10H2,3H3 |
| InChIKey | STDWCUOTTULCND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine?
The IUPAC name of 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine (CID 69381236) is 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine.
What is the SMILES notation for 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine?
The canonical SMILES for 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine is C=CCCC(C)(NCC=C)N1C=NCC1.
What is the InChIKey of 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine?
The InChIKey is STDWCUOTTULCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-4-6-7-12(3,14-8-5-2)15-10-9-13-11-15/h4-5,11,14H,1-2,6-10H2,3H3.
What are the key properties of 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine?
2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine has a molecular weight of 207.32 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydroimidazol-1-yl)-N-prop-2-enylhex-5-en-2-amine is sourced from PubChem (CID 69381236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).