C6H5N7O3 — CID 69381390
(5-methyl-3-nitro-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone (PubChem CID 69381390) has the molecular formula C6H5N7O3 and a molecular weight of 223.15 g/mol. Its IUPAC name is (5-methyl-3-nitro-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone.
| Compound Name | (5-methyl-3-nitro-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69381390 |
| Molecular Formula | C6H5N7O3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (5-methyl-3-nitro-1,2,4-triazol-1-yl)-(1,2,4-triazol-1-yl)methanone |
| SMILES | Cc1nc([N+](=O)[O-])nn1C(=O)n1cncn1 |
| InChI | InChI=1S/C6H5N7O3/c1-4-9-5(13(15)16)10-12(4)6(14)11-3-7-2-8-11/h2-3H,1H3 |
| InChIKey | POUHQRRDNIJDIZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|