C12H16N2 — CID 69381566
2,3,4,6,6a,7-hexahydro-1H-pyrazino[1,2-b]isoquinoline (PubChem CID 69381566) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,3,4,6,6a,7-hexahydro-1H-pyrazino[1,2-b]isoquinoline.
| Compound Name | 2,3,4,6,6a,7-hexahydro-1H-pyrazino[1,2-b]isoquinoline |
|---|---|
| PubChem CID | 69381566 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,3,4,6,6a,7-hexahydro-1H-pyrazino[1,2-b]isoquinoline |
| SMILES | C1=CCC2CN3CCNCC3=CC2=C1 |
| InChI | InChI=1S/C12H16N2/c1-2-4-11-9-14-6-5-13-8-12(14)7-10(11)3-1/h1-3,7,11,13H,4-6,8-9H2 |
| InChIKey | RCNCDMXFKPNPLQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |