C6H2Cl3FN6O — CID 69381701
[3-fluoro-5-(trichloromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 69381701) has the molecular formula C6H2Cl3FN6O and a molecular weight of 299.48 g/mol. Its IUPAC name is [3-fluoro-5-(trichloromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [3-fluoro-5-(trichloromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69381701 |
| Molecular Formula | C6H2Cl3FN6O |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 297.93 |
| IUPAC Name | [3-fluoro-5-(trichloromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | O=C(n1cncn1)n1nc(F)nc1C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H2Cl3FN6O/c7-6(8,9)3-13-4(10)14-16(3)5(17)15-2-11-1-12-15/h1-2H |
| InChIKey | XDBKWXXMYAZBCU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|