C11H13F3N6O — CID 69381830
[5-pentyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone (PubChem CID 69381830) has the molecular formula C11H13F3N6O and a molecular weight of 302.26 g/mol. Its IUPAC name is [5-pentyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone.
| Compound Name | [5-pentyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
|---|---|
| PubChem CID | 69381830 |
| Molecular Formula | C11H13F3N6O |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [5-pentyl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]-(1,2,4-triazol-1-yl)methanone |
| SMILES | CCCCCc1nc(C(F)(F)F)nn1C(=O)n1cncn1 |
| InChI | InChI=1S/C11H13F3N6O/c1-2-3-4-5-8-17-9(11(12,13)14)18-20(8)10(21)19-7-15-6-16-19/h6-7H,2-5H2,1H3 |
| InChIKey | BKHALWCTRRBRTK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|