C10H16Cl5N3 — CID 69381848
4-(1,1,2,2,2-pentachloroethyl)-3-propan-2-yl-2-propyl-3H-1,2,4-triazole (PubChem CID 69381848) has the molecular formula C10H16Cl5N3 and a molecular weight of 355.52 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentachloroethyl)-3-propan-2-yl-2-propyl-3H-1,2,4-triazole.
| Compound Name | 4-(1,1,2,2,2-pentachloroethyl)-3-propan-2-yl-2-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69381848 |
| Molecular Formula | C10H16Cl5N3 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | 4-(1,1,2,2,2-pentachloroethyl)-3-propan-2-yl-2-propyl-3H-1,2,4-triazole |
| SMILES | CCCN1N=CN(C(Cl)(Cl)C(Cl)(Cl)Cl)C1C(C)C |
| InChI | InChI=1S/C10H16Cl5N3/c1-4-5-18-8(7(2)3)17(6-16-18)10(14,15)9(11,12)13/h6-8H,4-5H2,1-3H3 |
| InChIKey | DZCNQLIAIVISMA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|