About 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid
4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 69381984) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 69381984 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CCCC1(OCC)C=C(OCC)C=CC1C(=O)O |
| InChI | InChI=1S/C14H22O4/c1-4-9-14(18-6-3)10-11(17-5-2)7-8-12(14)13(15)16/h7-8,10,12H,4-6,9H2,1-3H3,(H,15,16) |
| InChIKey | LGOSQTNQLRZLDR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid (CID 69381984) is 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid is CCCC1(OCC)C=C(OCC)C=CC1C(=O)O.
What is the InChIKey of 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is LGOSQTNQLRZLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-4-9-14(18-6-3)10-11(17-5-2)7-8-12(14)13(15)16/h7-8,10,12H,4-6,9H2,1-3H3,(H,15,16).
What are the key properties of 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid?
4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 254.33 g/mol, XLogP of 2.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethoxy-6-propylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 69381984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).