C5H5Cl5N4 — CID 69382124
5-ethyl-5-(1,1,2,2,2-pentachloroethyl)tetrazole (PubChem CID 69382124) has the molecular formula C5H5Cl5N4 and a molecular weight of 298.39 g/mol. Its IUPAC name is 5-ethyl-5-(1,1,2,2,2-pentachloroethyl)tetrazole.
| Compound Name | 5-ethyl-5-(1,1,2,2,2-pentachloroethyl)tetrazole |
|---|---|
| PubChem CID | 69382124 |
| Molecular Formula | C5H5Cl5N4 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 295.90 |
| IUPAC Name | 5-ethyl-5-(1,1,2,2,2-pentachloroethyl)tetrazole |
| SMILES | CCC1(C(Cl)(Cl)C(Cl)(Cl)Cl)N=NN=N1 |
| InChI | InChI=1S/C5H5Cl5N4/c1-2-3(11-13-14-12-3)4(6,7)5(8,9)10/h2H2,1H3 |
| InChIKey | HOMBXPCPTMLGMN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|