C33H34O7 — CID 69382156
methyl 3-benzyl-2-[[4-methyl-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate (PubChem CID 69382156) has the molecular formula C33H34O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is methyl 3-benzyl-2-[[4-methyl-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate.
| Compound Name | methyl 3-benzyl-2-[[4-methyl-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate |
|---|---|
| PubChem CID | 69382156 |
| Molecular Formula | C33H34O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | methyl 3-benzyl-2-[[4-methyl-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]azulene-1-carboxylate |
| SMILES | COC(=O)c1c2cccccc-2c(Cc2ccccc2)c1Cc1ccc(C)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C33H34O7/c1-19-13-14-21(16-24(19)32-31(37)30(36)29(35)27(18-34)40-32)17-26-25(15-20-9-5-3-6-10-20)22-11-7-4-8-12-23(22)28(26)33(38)39-2/h3-14,16,27,29-32,34-37H,15,17-18H2,1-2H3/t27-,29-,30+,31+,32+/m1/s1 |
| InChIKey | XADJBZLKSRQJCI-AIXQGADWSA-N |
| XLogP | 3.58 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |