C38H46N6O8 — CID 69382475
5-amino-6-[bis[2-[(6-methyl-2-oxo-3-phenylmethoxy-1H-pyridine-4-carbonyl)amino]ethyl]amino]hexanoic acid (PubChem CID 69382475) has the molecular formula C38H46N6O8 and a molecular weight of 714.82 g/mol. Its IUPAC name is 5-amino-6-[bis[2-[(6-methyl-2-oxo-3-phenylmethoxy-1H-pyridine-4-carbonyl)amino]ethyl]amino]hexanoic acid.
| Compound Name | 5-amino-6-[bis[2-[(6-methyl-2-oxo-3-phenylmethoxy-1H-pyridine-4-carbonyl)amino]ethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 69382475 |
| Molecular Formula | C38H46N6O8 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | 5-amino-6-[bis[2-[(6-methyl-2-oxo-3-phenylmethoxy-1H-pyridine-4-carbonyl)amino]ethyl]amino]hexanoic acid |
| SMILES | Cc1cc(C(=O)NCCN(CCNC(=O)c2cc(C)[nH]c(=O)c2OCc2ccccc2)CC(N)CCCC(=O)O)c(OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C38H46N6O8/c1-25-20-30(33(37(49)42-25)51-23-27-10-5-3-6-11-27)35(47)40-16-18-44(22-29(39)14-9-15-32(45)46)19-17-41-36(48)31-21-26(2)43-38(50)34(31)52-24-28-12-7-4-8-13-28/h3-8,10-13,20-21,29H,9,14-19,22-24,39H2,1-2H3,(H,40,47)(H,41,48)(H,42,49)(H,43,50)(H,45,46) |
| InChIKey | GSUWDOKWNZNPIM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 208.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |