C6H3Cl5N4 — CID 69383082
1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole-4-carbonitrile (PubChem CID 69383082) has the molecular formula C6H3Cl5N4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole-4-carbonitrile.
| Compound Name | 1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole-4-carbonitrile |
|---|---|
| PubChem CID | 69383082 |
| Molecular Formula | C6H3Cl5N4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 305.88 |
| IUPAC Name | 1-methyl-5-(1,1,2,2,2-pentachloroethyl)triazole-4-carbonitrile |
| SMILES | Cn1nnc(C#N)c1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H3Cl5N4/c1-15-4(3(2-12)13-14-15)5(7,8)6(9,10)11/h1H3 |
| InChIKey | MDBCTQZMNUKGOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|