About 1-butyl-4,5-difluorotriazole
1-butyl-4,5-difluorotriazole (PubChem CID 69383142) has the molecular formula C6H9F2N3
and a molecular weight of 161.16 g/mol. Its IUPAC name is 1-butyl-4,5-difluorotriazole.
Molecular Properties
| Compound Name | 1-butyl-4,5-difluorotriazole |
| PubChem CID | 69383142 |
| Molecular Formula | C6H9F2N3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-butyl-4,5-difluorotriazole |
| SMILES | CCCCn1nnc(F)c1F |
| InChI | InChI=1S/C6H9F2N3/c1-2-3-4-11-6(8)5(7)9-10-11/h2-4H2,1H3 |
| InChIKey | HGBVMOFWUNRYOL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4,5-difluorotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4,5-difluorotriazole?
The IUPAC name of 1-butyl-4,5-difluorotriazole (CID 69383142) is 1-butyl-4,5-difluorotriazole.
What is the SMILES notation for 1-butyl-4,5-difluorotriazole?
The canonical SMILES for 1-butyl-4,5-difluorotriazole is CCCCn1nnc(F)c1F.
What is the InChIKey of 1-butyl-4,5-difluorotriazole?
The InChIKey is HGBVMOFWUNRYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2N3/c1-2-3-4-11-6(8)5(7)9-10-11/h2-4H2,1H3.
What are the key properties of 1-butyl-4,5-difluorotriazole?
1-butyl-4,5-difluorotriazole has a molecular weight of 161.16 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4,5-difluorotriazole is sourced from PubChem (CID 69383142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).