C11H18Cl5N3 — CID 69383838
4-(2-methylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-2-propan-2-yl-3H-1,2,4-triazole (PubChem CID 69383838) has the molecular formula C11H18Cl5N3 and a molecular weight of 369.55 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-2-propan-2-yl-3H-1,2,4-triazole.
| Compound Name | 4-(2-methylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-2-propan-2-yl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69383838 |
| Molecular Formula | C11H18Cl5N3 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 4-(2-methylpropyl)-3-(1,1,2,2,2-pentachloroethyl)-2-propan-2-yl-3H-1,2,4-triazole |
| SMILES | CC(C)CN1C=NN(C(C)C)C1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl5N3/c1-7(2)5-18-6-17-19(8(3)4)9(18)10(12,13)11(14,15)16/h6-9H,5H2,1-4H3 |
| InChIKey | JHCYJDLXRGHFBX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|