About 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole
1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole (PubChem CID 69383979) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole.
Molecular Properties
| Compound Name | 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole |
| PubChem CID | 69383979 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole |
| SMILES | CCCCn1nnc(CCC)c1CC(C)(C)C |
| InChI | InChI=1S/C14H27N3/c1-6-8-10-17-13(11-14(3,4)5)12(9-7-2)15-16-17/h6-11H2,1-5H3 |
| InChIKey | HOPCVKXHJOSMDS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole?
The IUPAC name of 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole (CID 69383979) is 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole.
What is the SMILES notation for 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole?
The canonical SMILES for 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole is CCCCn1nnc(CCC)c1CC(C)(C)C.
What is the InChIKey of 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole?
The InChIKey is HOPCVKXHJOSMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3/c1-6-8-10-17-13(11-14(3,4)5)12(9-7-2)15-16-17/h6-11H2,1-5H3.
What are the key properties of 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole?
1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole has a molecular weight of 237.39 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-(2,2-dimethylpropyl)-4-propyltriazole is sourced from PubChem (CID 69383979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).