About 5-chloro-1,4-dipropyltriazole
5-chloro-1,4-dipropyltriazole (PubChem CID 69384008) has the molecular formula C8H14ClN3
and a molecular weight of 187.67 g/mol. Its IUPAC name is 5-chloro-1,4-dipropyltriazole.
Molecular Properties
| Compound Name | 5-chloro-1,4-dipropyltriazole |
| PubChem CID | 69384008 |
| Molecular Formula | C8H14ClN3 |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 5-chloro-1,4-dipropyltriazole |
| SMILES | CCCc1nnn(CCC)c1Cl |
| InChI | InChI=1S/C8H14ClN3/c1-3-5-7-8(9)12(6-4-2)11-10-7/h3-6H2,1-2H3 |
| InChIKey | UAEJUAGEKRDXQP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1,4-dipropyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,4-dipropyltriazole?
The IUPAC name of 5-chloro-1,4-dipropyltriazole (CID 69384008) is 5-chloro-1,4-dipropyltriazole.
What is the SMILES notation for 5-chloro-1,4-dipropyltriazole?
The canonical SMILES for 5-chloro-1,4-dipropyltriazole is CCCc1nnn(CCC)c1Cl.
What is the InChIKey of 5-chloro-1,4-dipropyltriazole?
The InChIKey is UAEJUAGEKRDXQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3/c1-3-5-7-8(9)12(6-4-2)11-10-7/h3-6H2,1-2H3.
What are the key properties of 5-chloro-1,4-dipropyltriazole?
5-chloro-1,4-dipropyltriazole has a molecular weight of 187.67 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,4-dipropyltriazole is sourced from PubChem (CID 69384008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).