C16H20N2O3 — CID 69384219
(6S,8aS)-6-(4-methoxy-2,3-dimethylphenyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 69384219) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (6S,8aS)-6-(4-methoxy-2,3-dimethylphenyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (6S,8aS)-6-(4-methoxy-2,3-dimethylphenyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 69384219 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (6S,8aS)-6-(4-methoxy-2,3-dimethylphenyl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | COc1ccc([C@@H]2CC[C@H]3C(=O)NCC(=O)N32)c(C)c1C |
| InChI | InChI=1S/C16H20N2O3/c1-9-10(2)14(21-3)7-4-11(9)12-5-6-13-16(20)17-8-15(19)18(12)13/h4,7,12-13H,5-6,8H2,1-3H3,(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | YJJHCXRZPHPFDG-STQMWFEESA-N |
| XLogP | 1.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |