About 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile
4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile (PubChem CID 69384500) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 69384500 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCN1N=CN(C)C1C#N |
| InChI | InChI=1S/C7H12N4/c1-3-4-11-7(5-8)10(2)6-9-11/h6-7H,3-4H2,1-2H3 |
| InChIKey | DDSRMRNURIFWQH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile (CID 69384500) is 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile is CCCN1N=CN(C)C1C#N.
What is the InChIKey of 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile?
The InChIKey is DDSRMRNURIFWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-3-4-11-7(5-8)10(2)6-9-11/h6-7H,3-4H2,1-2H3.
What are the key properties of 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile?
4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile has a molecular weight of 152.20 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-propyl-3H-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 69384500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).