C9H14Cl5N3 — CID 69384514
2-ethyl-4-(1,1,2,2,2-pentachloroethyl)-3-propyl-3H-1,2,4-triazole (PubChem CID 69384514) has the molecular formula C9H14Cl5N3 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-ethyl-4-(1,1,2,2,2-pentachloroethyl)-3-propyl-3H-1,2,4-triazole.
| Compound Name | 2-ethyl-4-(1,1,2,2,2-pentachloroethyl)-3-propyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69384514 |
| Molecular Formula | C9H14Cl5N3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 2-ethyl-4-(1,1,2,2,2-pentachloroethyl)-3-propyl-3H-1,2,4-triazole |
| SMILES | CCCC1N(CC)N=CN1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl5N3/c1-3-5-7-16(6-15-17(7)4-2)9(13,14)8(10,11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | ABXPUUSVDFDVTH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|