C18H24N2O3 — CID 6938468
N-[(1S,2R)-2-methylcyclohexyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide (PubChem CID 6938468) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
|---|---|
| PubChem CID | 6938468 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-3-(3-oxo-1,4-benzoxazin-4-yl)propanamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)CCN1C(=O)COc2ccccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-13-6-2-3-7-14(13)19-17(21)10-11-20-15-8-4-5-9-16(15)23-12-18(20)22/h4-5,8-9,13-14H,2-3,6-7,10-12H2,1H3,(H,19,21)/t13-,14+/m1/s1 |
| InChIKey | NDRCUKOEPWSDJL-KGLIPLIRSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |