methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate

C11H15NO6S2 — CID 69384728

IUPACmethyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate
SMILESCOC(=O)Cc1ccccc1N(S(C)(=O)=O)S(C)(=O)=O
InChIInChI=1S/C11H15NO6S2/c1-18-11(13)8-9-6-4-5-7-10(9)12(19(2,14)15)20(3,16)17/h4-7H,8H2,1-3H3
InChIKeyULZFJEAAMDTJHN-UHFFFAOYSA-N
MW321.38 g/mol
LogP0.13
Rot. Bonds5

About methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate

methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate (PubChem CID 69384728) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate
PubChem CID69384728
Molecular FormulaC11H15NO6S2
Molecular Weight321.38 g/mol
Exact Mass321.03
IUPAC Namemethyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate
SMILESCOC(=O)Cc1ccccc1N(S(C)(=O)=O)S(C)(=O)=O
InChIInChI=1S/C11H15NO6S2/c1-18-11(13)8-9-6-4-5-7-10(9)12(19(2,14)15)20(3,16)17/h4-7H,8H2,1-3H3
InChIKeyULZFJEAAMDTJHN-UHFFFAOYSA-N
XLogP0.13
TPSA97.82 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.38
LogP ≤ 50.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate?
The IUPAC name of methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate (CID 69384728) is methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate.
What is the SMILES notation for methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate?
The canonical SMILES for methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate is COC(=O)Cc1ccccc1N(S(C)(=O)=O)S(C)(=O)=O.
What is the InChIKey of methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate?
The InChIKey is ULZFJEAAMDTJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO6S2/c1-18-11(13)8-9-6-4-5-7-10(9)12(19(2,14)15)20(3,16)17/h4-7H,8H2,1-3H3.
What are the key properties of methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate?
methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate has a molecular weight of 321.38 g/mol, XLogP of 0.13, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[bis(methylsulfonyl)amino]phenyl]acetate is sourced from PubChem (CID 69384728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).