C5H11N3 — CID 69384775
2,3,4-trimethyl-3H-1,2,4-triazole (PubChem CID 69384775) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 2,3,4-trimethyl-3H-1,2,4-triazole.
| Compound Name | 2,3,4-trimethyl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69384775 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2,3,4-trimethyl-3H-1,2,4-triazole |
| SMILES | CC1N(C)C=NN1C |
| InChI | InChI=1S/C5H11N3/c1-5-7(2)4-6-8(5)3/h4-5H,1-3H3 |
| InChIKey | KRPUVNUVQFPLHH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |