About 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile
2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile (PubChem CID 69384780) has the molecular formula C5H8N4
and a molecular weight of 124.15 g/mol. Its IUPAC name is 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 69384780 |
| Molecular Formula | C5H8N4 |
| Molecular Weight | 124.15 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile |
| SMILES | CN1C=NN(C)C1C#N |
| InChI | InChI=1S/C5H8N4/c1-8-4-7-9(2)5(8)3-6/h4-5H,1-2H3 |
| InChIKey | OWQDNVZISWSWLF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile (CID 69384780) is 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile is CN1C=NN(C)C1C#N.
What is the InChIKey of 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile?
The InChIKey is OWQDNVZISWSWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4/c1-8-4-7-9(2)5(8)3-6/h4-5H,1-2H3.
What are the key properties of 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile?
2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile has a molecular weight of 124.15 g/mol, XLogP of -0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3H-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 69384780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).