C4H6ClN3 — CID 69384820
4-chloro-1,5-dimethyltriazole (PubChem CID 69384820) has the molecular formula C4H6ClN3 and a molecular weight of 131.57 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyltriazole.
| Compound Name | 4-chloro-1,5-dimethyltriazole |
|---|---|
| PubChem CID | 69384820 |
| Molecular Formula | C4H6ClN3 |
| Molecular Weight | 131.57 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 4-chloro-1,5-dimethyltriazole |
| SMILES | Cc1c(Cl)nnn1C |
| InChI | InChI=1S/C4H6ClN3/c1-3-4(5)6-7-8(3)2/h1-2H3 |
| InChIKey | SQDKJTDJFDVYJM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.57 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |