About 4-chloro-1,5-dimethyltriazole
4-chloro-1,5-dimethyltriazole (PubChem CID 69384820) has the molecular formula C4H6ClN3
and a molecular weight of 131.57 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyltriazole.
Molecular Properties
| Compound Name | 4-chloro-1,5-dimethyltriazole |
| PubChem CID | 69384820 |
| Molecular Formula | C4H6ClN3 |
| Molecular Weight | 131.57 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 4-chloro-1,5-dimethyltriazole |
| SMILES | Cc1c(Cl)nnn1C |
| InChI | InChI=1S/C4H6ClN3/c1-3-4(5)6-7-8(3)2/h1-2H3 |
| InChIKey | SQDKJTDJFDVYJM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.57 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1,5-dimethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,5-dimethyltriazole?
The IUPAC name of 4-chloro-1,5-dimethyltriazole (CID 69384820) is 4-chloro-1,5-dimethyltriazole.
What is the SMILES notation for 4-chloro-1,5-dimethyltriazole?
The canonical SMILES for 4-chloro-1,5-dimethyltriazole is Cc1c(Cl)nnn1C.
What is the InChIKey of 4-chloro-1,5-dimethyltriazole?
The InChIKey is SQDKJTDJFDVYJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClN3/c1-3-4(5)6-7-8(3)2/h1-2H3.
What are the key properties of 4-chloro-1,5-dimethyltriazole?
4-chloro-1,5-dimethyltriazole has a molecular weight of 131.57 g/mol, XLogP of 0.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,5-dimethyltriazole is sourced from PubChem (CID 69384820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).