[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate

C17H10Cl2N2O4 — CID 69385267

IUPAC[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate
SMILESO=C(O)Oc1cnc(-c2ccccc2)nc1Oc1cccc(Cl)c1Cl
InChIInChI=1S/C17H10Cl2N2O4/c18-11-7-4-8-12(14(11)19)24-16-13(25-17(22)23)9-20-15(21-16)10-5-2-1-3-6-10/h1-9H,(H,22,23)
InChIKeyFYGQLYPLPDXCNB-UHFFFAOYSA-N
MW377.18 g/mol
LogP5.30
Rot. Bonds4

About [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate

[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate (PubChem CID 69385267) has the molecular formula C17H10Cl2N2O4 and a molecular weight of 377.18 g/mol. Its IUPAC name is [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate.

Molecular Properties

Compound Name[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate
PubChem CID69385267
Molecular FormulaC17H10Cl2N2O4
Molecular Weight377.18 g/mol
Exact Mass376.00
IUPAC Name[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate
SMILESO=C(O)Oc1cnc(-c2ccccc2)nc1Oc1cccc(Cl)c1Cl
InChIInChI=1S/C17H10Cl2N2O4/c18-11-7-4-8-12(14(11)19)24-16-13(25-17(22)23)9-20-15(21-16)10-5-2-1-3-6-10/h1-9H,(H,22,23)
InChIKeyFYGQLYPLPDXCNB-UHFFFAOYSA-N
XLogP5.30
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms25
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500377.18
LogP ≤ 55.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate?
The IUPAC name of [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate (CID 69385267) is [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate.
What is the SMILES notation for [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate?
The canonical SMILES for [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate is O=C(O)Oc1cnc(-c2ccccc2)nc1Oc1cccc(Cl)c1Cl.
What is the InChIKey of [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate?
The InChIKey is FYGQLYPLPDXCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2N2O4/c18-11-7-4-8-12(14(11)19)24-16-13(25-17(22)23)9-20-15(21-16)10-5-2-1-3-6-10/h1-9H,(H,22,23).
What are the key properties of [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate?
[4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate has a molecular weight of 377.18 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-dichlorophenoxy)-2-phenylpyrimidin-5-yl] hydrogen carbonate is sourced from PubChem (CID 69385267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).