C17H16F3NO4S — CID 69385441
(2R,3R,4R,5S)-4-pyridin-2-yloxy-5-[4-(trifluoromethyl)phenoxy]thiane-2,3-diol (PubChem CID 69385441) has the molecular formula C17H16F3NO4S and a molecular weight of 387.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-pyridin-2-yloxy-5-[4-(trifluoromethyl)phenoxy]thiane-2,3-diol.
| Compound Name | (2R,3R,4R,5S)-4-pyridin-2-yloxy-5-[4-(trifluoromethyl)phenoxy]thiane-2,3-diol |
|---|---|
| PubChem CID | 69385441 |
| Molecular Formula | C17H16F3NO4S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (2R,3R,4R,5S)-4-pyridin-2-yloxy-5-[4-(trifluoromethyl)phenoxy]thiane-2,3-diol |
| SMILES | O[C@@H]1[C@@H](Oc2ccccn2)[C@H](Oc2ccc(C(F)(F)F)cc2)CS[C@H]1O |
| InChI | InChI=1S/C17H16F3NO4S/c18-17(19,20)10-4-6-11(7-5-10)24-12-9-26-16(23)14(22)15(12)25-13-3-1-2-8-21-13/h1-8,12,14-16,22-23H,9H2/t12-,14-,15+,16-/m1/s1 |
| InChIKey | NSZQLCAJQKFNPH-DMRZNYOFSA-N |
| XLogP | 2.72 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |