About 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline
2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline (PubChem CID 69385619) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline.
Molecular Properties
| Compound Name | 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline |
| PubChem CID | 69385619 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline |
| SMILES | Cc1nc2ccccc2cc1-c1ncn[nH]1 |
| InChI | InChI=1S/C12H10N4/c1-8-10(12-13-7-14-16-12)6-9-4-2-3-5-11(9)15-8/h2-7H,1H3,(H,13,14,16) |
| InChIKey | AQISOQXEAMXUOL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline?
The IUPAC name of 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline (CID 69385619) is 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline.
What is the SMILES notation for 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline?
The canonical SMILES for 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline is Cc1nc2ccccc2cc1-c1ncn[nH]1.
What is the InChIKey of 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline?
The InChIKey is AQISOQXEAMXUOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c1-8-10(12-13-7-14-16-12)6-9-4-2-3-5-11(9)15-8/h2-7H,1H3,(H,13,14,16).
What are the key properties of 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline?
2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline has a molecular weight of 210.24 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1H-1,2,4-triazol-5-yl)quinoline is sourced from PubChem (CID 69385619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).