C7H10Cl5N3 — CID 69385913
3-ethyl-2-methyl-4-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole (PubChem CID 69385913) has the molecular formula C7H10Cl5N3 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-ethyl-2-methyl-4-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole.
| Compound Name | 3-ethyl-2-methyl-4-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69385913 |
| Molecular Formula | C7H10Cl5N3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | 3-ethyl-2-methyl-4-(1,1,2,2,2-pentachloroethyl)-3H-1,2,4-triazole |
| SMILES | CCC1N(C)N=CN1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl5N3/c1-3-5-14(2)13-4-15(5)7(11,12)6(8,9)10/h4-5H,3H2,1-2H3 |
| InChIKey | VZWHWTFQHICXDE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|