C20H32FN2+ — CID 6938604
1-(4-tert-butylcyclohexyl)-4-(4-fluorophenyl)piperazin-1-ium (PubChem CID 6938604) has the molecular formula C20H32FN2+ and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-4-(4-fluorophenyl)piperazin-1-ium.
| Compound Name | 1-(4-tert-butylcyclohexyl)-4-(4-fluorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6938604 |
| Molecular Formula | C20H32FN2+ |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-4-(4-fluorophenyl)piperazin-1-ium |
| SMILES | CC(C)(C)C1CCC([NH+]2CCN(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H31FN2/c1-20(2,3)16-4-8-18(9-5-16)22-12-14-23(15-13-22)19-10-6-17(21)7-11-19/h6-7,10-11,16,18H,4-5,8-9,12-15H2,1-3H3/p+1 |
| InChIKey | NUHMSVAMMHSEDG-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |