About [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane
[9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane (PubChem CID 69386897) has the molecular formula C29H42Si
and a molecular weight of 418.74 g/mol. Its IUPAC name is [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane |
| PubChem CID | 69386897 |
| Molecular Formula | C29H42Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane |
| SMILES | C=CCc1ccc2c(c1)C(CC(C)CC)(CC(C)CC)c1cc([Si](C)(C)C)ccc1-2 |
| InChI | InChI=1S/C29H42Si/c1-9-12-23-13-15-25-26-16-14-24(30(6,7)8)18-28(26)29(27(25)17-23,19-21(4)10-2)20-22(5)11-3/h9,13-18,21-22H,1,10-12,19-20H2,2-8H3 |
| InChIKey | MZZWLVYBBHZBDM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane?
The IUPAC name of [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane (CID 69386897) is [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane.
What is the SMILES notation for [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane?
The canonical SMILES for [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane is C=CCc1ccc2c(c1)C(CC(C)CC)(CC(C)CC)c1cc([Si](C)(C)C)ccc1-2.
What is the InChIKey of [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane?
The InChIKey is MZZWLVYBBHZBDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H42Si/c1-9-12-23-13-15-25-26-16-14-24(30(6,7)8)18-28(26)29(27(25)17-23,19-21(4)10-2)20-22(5)11-3/h9,13-18,21-22H,1,10-12,19-20H2,2-8H3.
What are the key properties of [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane?
[9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane has a molecular weight of 418.74 g/mol, XLogP of 8.10, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [9,9-bis(2-methylbutyl)-7-prop-2-enylfluoren-2-yl]-trimethylsilane is sourced from PubChem (CID 69386897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).