About 5-methyl-8-nitropyrido[4,3-b]indole
5-methyl-8-nitropyrido[4,3-b]indole (PubChem CID 693871) has the molecular formula C12H9N3O2
and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-methyl-8-nitropyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 5-methyl-8-nitropyrido[4,3-b]indole |
| PubChem CID | 693871 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-methyl-8-nitropyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H9N3O2/c1-14-11-3-2-8(15(16)17)6-9(11)10-7-13-5-4-12(10)14/h2-7H,1H3 |
| InChIKey | KKAZBBJRXDFIAA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-8-nitropyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-8-nitropyrido[4,3-b]indole?
The IUPAC name of 5-methyl-8-nitropyrido[4,3-b]indole (CID 693871) is 5-methyl-8-nitropyrido[4,3-b]indole.
What is the SMILES notation for 5-methyl-8-nitropyrido[4,3-b]indole?
The canonical SMILES for 5-methyl-8-nitropyrido[4,3-b]indole is Cn1c2ccncc2c2cc([N+](=O)[O-])ccc21.
What is the InChIKey of 5-methyl-8-nitropyrido[4,3-b]indole?
The InChIKey is KKAZBBJRXDFIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2/c1-14-11-3-2-8(15(16)17)6-9(11)10-7-13-5-4-12(10)14/h2-7H,1H3.
What are the key properties of 5-methyl-8-nitropyrido[4,3-b]indole?
5-methyl-8-nitropyrido[4,3-b]indole has a molecular weight of 227.22 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-8-nitropyrido[4,3-b]indole is sourced from PubChem (CID 693871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).